C22H26ClN3O5 — CID 94089620
N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-dimethoxybenzamide (PubChem CID 94089620) has the molecular formula C22H26ClN3O5 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 94089620 |
| Molecular Formula | C22H26ClN3O5 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(Cl)cc1N/C(=N/C[C@H]1CCCO1)NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26ClN3O5/c1-28-18-9-7-15(23)12-17(18)25-22(24-13-16-5-4-10-31-16)26-21(27)14-6-8-19(29-2)20(11-14)30-3/h6-9,11-12,16H,4-5,10,13H2,1-3H3,(H2,24,25,26,27)/t16-/m1/s1 |
| InChIKey | KNJMOIFLDUSDFN-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|