C21H23F2N3O3 — CID 94090268
3,4-difluoro-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide (PubChem CID 94090268) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is 3,4-difluoro-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide.
| Compound Name | 3,4-difluoro-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94090268 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3,4-difluoro-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
| SMILES | COc1ccc(C)cc1N/C(=N/C[C@H]1CCCO1)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H23F2N3O3/c1-13-5-8-19(28-2)18(10-13)25-21(24-12-15-4-3-9-29-15)26-20(27)14-6-7-16(22)17(23)11-14/h5-8,10-11,15H,3-4,9,12H2,1-2H3,(H2,24,25,26,27)/t15-/m1/s1 |
| InChIKey | RQPSCIURKRAXIN-OAHLLOKOSA-N |
| XLogP | 3.66 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|