C22H27N3O4 — CID 94090316
N-[N-(3,4-dimethoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 94090316) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[N-(3,4-dimethoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide.
| Compound Name | N-[N-(3,4-dimethoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 94090316 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[N-(3,4-dimethoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | COc1ccc(N/C(=N/C[C@H]2CCCO2)NC(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C22H27N3O4/c1-15-6-8-16(9-7-15)21(26)25-22(23-14-18-5-4-12-29-18)24-17-10-11-19(27-2)20(13-17)28-3/h6-11,13,18H,4-5,12,14H2,1-3H3,(H2,23,24,25,26)/t18-/m1/s1 |
| InChIKey | IPRZWFXQUDIHHL-GOSISDBHSA-N |
| XLogP | 3.39 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|