C22H24F3N3O4 — CID 94090297
N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 94090297) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 94090297 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(N/C(=N/C[C@@H]2CCCO2)NC(=O)c2ccc(C(F)(F)F)cc2)cc1OC |
| InChI | InChI=1S/C22H24F3N3O4/c1-30-18-10-9-16(12-19(18)31-2)27-21(26-13-17-4-3-11-32-17)28-20(29)14-5-7-15(8-6-14)22(23,24)25/h5-10,12,17H,3-4,11,13H2,1-2H3,(H2,26,27,28,29)/t17-/m0/s1 |
| InChIKey | SQKRAFCIMAGPBA-KRWDZBQOSA-N |
| XLogP | 4.10 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|