C21H22F3N3O2 — CID 94089806
N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 94089806) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 94089806 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cccc(N/C(=N/C[C@H]2CCCO2)NC(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H22F3N3O2/c1-14-4-2-5-17(12-14)26-20(25-13-18-6-3-11-29-18)27-19(28)15-7-9-16(10-8-15)21(22,23)24/h2,4-5,7-10,12,18H,3,6,11,13H2,1H3,(H2,25,26,27,28)/t18-/m1/s1 |
| InChIKey | RYYBMLIZCGXKGJ-GOSISDBHSA-N |
| XLogP | 4.39 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|