C20H22FN3O2 — CID 94090234
N-[N-(4-fluorophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 94090234) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is N-[N-(4-fluorophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide.
| Compound Name | N-[N-(4-fluorophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 94090234 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[N-(4-fluorophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=N\C[C@H]2CCCO2)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H22FN3O2/c1-14-4-6-15(7-5-14)19(25)24-20(22-13-18-3-2-12-26-18)23-17-10-8-16(21)9-11-17/h4-11,18H,2-3,12-13H2,1H3,(H2,22,23,24,25)/t18-/m1/s1 |
| InChIKey | VXUJSOPPRPHPHI-GOSISDBHSA-N |
| XLogP | 3.51 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|