C21H24FN3O4 — CID 94090306
N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide (PubChem CID 94090306) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 94090306 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[N-(3,4-dimethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide |
| SMILES | COc1ccc(N/C(=N/C[C@@H]2CCCO2)NC(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C21H24FN3O4/c1-27-18-10-9-16(12-19(18)28-2)24-21(23-13-17-4-3-11-29-17)25-20(26)14-5-7-15(22)8-6-14/h5-10,12,17H,3-4,11,13H2,1-2H3,(H2,23,24,25,26)/t17-/m0/s1 |
| InChIKey | WQDIKVZQNYBECG-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|