C19H19BrFN3O2 — CID 94089526
N-[N-(4-bromophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide (PubChem CID 94089526) has the molecular formula C19H19BrFN3O2 and a molecular weight of 420.28 g/mol. Its IUPAC name is N-[N-(4-bromophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N-(4-bromophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 94089526 |
| Molecular Formula | C19H19BrFN3O2 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-[N-(4-bromophenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide |
| SMILES | O=C(N/C(=N\C[C@H]1CCCO1)Nc1ccc(Br)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19BrFN3O2/c20-14-5-9-16(10-6-14)23-19(22-12-17-2-1-11-26-17)24-18(25)13-3-7-15(21)8-4-13/h3-10,17H,1-2,11-12H2,(H2,22,23,24,25)/t17-/m1/s1 |
| InChIKey | KRWVAUYWWKFZRT-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|