C21H24FN3O2 — CID 50817583
N-[N-(3,4-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-fluorobenzamide (PubChem CID 50817583) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[N-(3,4-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N-(3,4-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 50817583 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[N-(3,4-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-fluorobenzamide |
| SMILES | Cc1ccc(N/C(=N/CC2CCCO2)NC(=O)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C21H24FN3O2/c1-14-5-10-18(12-15(14)2)24-21(23-13-19-4-3-11-27-19)25-20(26)16-6-8-17(22)9-7-16/h5-10,12,19H,3-4,11,13H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | QJBCZOVPZBMSTG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|