C22H26FN3O2 — CID 94089852
4-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide (PubChem CID 94089852) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide.
| Compound Name | 4-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94089852 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
| SMILES | CC(C)c1ccc(N/C(=N/C[C@H]2CCCO2)NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H26FN3O2/c1-15(2)16-7-11-19(12-8-16)25-22(24-14-20-4-3-13-28-20)26-21(27)17-5-9-18(23)10-6-17/h5-12,15,20H,3-4,13-14H2,1-2H3,(H2,24,25,26,27)/t20-/m1/s1 |
| InChIKey | KONOUHFWRMCWGS-HXUWFJFHSA-N |
| XLogP | 4.33 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|