C23H29N3O2 — CID 50817470
3-methyl-N-[N'-(oxolan-2-ylmethyl)-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide (PubChem CID 50817470) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-methyl-N-[N'-(oxolan-2-ylmethyl)-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide.
| Compound Name | 3-methyl-N-[N'-(oxolan-2-ylmethyl)-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50817470 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 3-methyl-N-[N'-(oxolan-2-ylmethyl)-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
| SMILES | Cc1cccc(C(=O)N/C(=N\CC2CCCO2)Nc2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C23H29N3O2/c1-16(2)18-9-11-20(12-10-18)25-23(24-15-21-8-5-13-28-21)26-22(27)19-7-4-6-17(3)14-19/h4,6-7,9-12,14,16,21H,5,8,13,15H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | PGEVDNBZDXGXQM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|