C22H26N4O3 — CID 94089816
4-acetamido-N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide (PubChem CID 94089816) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-acetamido-N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide.
| Compound Name | 4-acetamido-N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94089816 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-acetamido-N-[N-(3-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)N/C(=N\C[C@H]2CCCO2)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-15-5-3-6-19(13-15)25-22(23-14-20-7-4-12-29-20)26-21(28)17-8-10-18(11-9-17)24-16(2)27/h3,5-6,8-11,13,20H,4,7,12,14H2,1-2H3,(H,24,27)(H2,23,25,26,28)/t20-/m1/s1 |
| InChIKey | UULBEZNWFMQIPP-HXUWFJFHSA-N |
| XLogP | 3.33 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|