C23H27N3O4 — CID 94089732
ethyl 4-[[N-(3-methylbenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate (PubChem CID 94089732) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is ethyl 4-[[N-(3-methylbenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate.
| Compound Name | ethyl 4-[[N-(3-methylbenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 94089732 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 4-[[N-(3-methylbenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N/C(=N/C[C@H]2CCCO2)NC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-3-29-22(28)17-9-11-19(12-10-17)25-23(24-15-20-8-5-13-30-20)26-21(27)18-7-4-6-16(2)14-18/h4,6-7,9-12,14,20H,3,5,8,13,15H2,1-2H3,(H2,24,25,26,27)/t20-/m1/s1 |
| InChIKey | KBYCLFUELAOHBS-HXUWFJFHSA-N |
| XLogP | 3.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|