C20H21F2N3O2 — CID 50819996
N-[N-(3,5-difluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methylbenzamide (PubChem CID 50819996) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is N-[N-(3,5-difluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methylbenzamide.
| Compound Name | N-[N-(3,5-difluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 50819996 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[N-(3,5-difluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=N\CC2CCCO2)Nc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C20H21F2N3O2/c1-13-4-2-5-14(8-13)19(26)25-20(23-12-18-6-3-7-27-18)24-17-10-15(21)9-16(22)11-17/h2,4-5,8-11,18H,3,6-7,12H2,1H3,(H2,23,24,25,26) |
| InChIKey | OMYMIFWRMFJMBX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|