C22H27N3O2 — CID 94089975
N-[N-(2-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3-methylbenzamide (PubChem CID 94089975) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[N-(2-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3-methylbenzamide.
| Compound Name | N-[N-(2-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 94089975 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[N-(2-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3-methylbenzamide |
| SMILES | CCc1ccccc1N/C(=N/C[C@H]1CCCO1)NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-3-17-9-4-5-12-20(17)24-22(23-15-19-11-7-13-27-19)25-21(26)18-10-6-8-16(2)14-18/h4-6,8-10,12,14,19H,3,7,11,13,15H2,1-2H3,(H2,23,24,25,26)/t19-/m1/s1 |
| InChIKey | SYRJORRPRKQQJP-LJQANCHMSA-N |
| XLogP | 3.93 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|