C23H29N3O2 — CID 94089986
4-ethyl-N-[N-(2-ethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide (PubChem CID 94089986) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-ethyl-N-[N-(2-ethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide.
| Compound Name | 4-ethyl-N-[N-(2-ethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94089986 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-ethyl-N-[N-(2-ethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
| SMILES | CCc1ccc(C(=O)N/C(=N\C[C@@H]2CCCO2)Nc2ccccc2CC)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-3-17-11-13-19(14-12-17)22(27)26-23(24-16-20-9-7-15-28-20)25-21-10-6-5-8-18(21)4-2/h5-6,8,10-14,20H,3-4,7,9,15-16H2,1-2H3,(H2,24,25,26,27)/t20-/m0/s1 |
| InChIKey | IVUBOTHLIUNMOY-FQEVSTJZSA-N |
| XLogP | 4.19 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|