C23H28N4O3 — CID 94090564
3-acetamido-N-[N-(4-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide (PubChem CID 94090564) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-acetamido-N-[N-(4-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide.
| Compound Name | 3-acetamido-N-[N-(4-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94090564 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-acetamido-N-[N-(4-ethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
| SMILES | CCc1ccc(N/C(=N/C[C@H]2CCCO2)NC(=O)c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-3-17-9-11-19(12-10-17)26-23(24-15-21-8-5-13-30-21)27-22(29)18-6-4-7-20(14-18)25-16(2)28/h4,6-7,9-12,14,21H,3,5,8,13,15H2,1-2H3,(H,25,28)(H2,24,26,27,29)/t21-/m1/s1 |
| InChIKey | SLCLMRTWSHWKQE-OAQYLSRUSA-N |
| XLogP | 3.58 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|