C22H25N3O5 — CID 94090019
methyl 3-[[N-(3-methoxybenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate (PubChem CID 94090019) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is methyl 3-[[N-(3-methoxybenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate.
| Compound Name | methyl 3-[[N-(3-methoxybenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 94090019 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | methyl 3-[[N-(3-methoxybenzoyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(N/C(=N/C[C@H]2CCCO2)NC(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C22H25N3O5/c1-28-18-9-4-6-15(13-18)20(26)25-22(23-14-19-10-5-11-30-19)24-17-8-3-7-16(12-17)21(27)29-2/h3-4,6-9,12-13,19H,5,10-11,14H2,1-2H3,(H2,23,24,25,26)/t19-/m1/s1 |
| InChIKey | UIGBGFBYCLWEPR-LJQANCHMSA-N |
| XLogP | 2.86 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|