C21H24ClN3O4 — CID 50820077
N-[N-(3-chloro-4-methoxyphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methoxybenzamide (PubChem CID 50820077) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-[N-(3-chloro-4-methoxyphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methoxybenzamide.
| Compound Name | N-[N-(3-chloro-4-methoxyphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 50820077 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[N-(3-chloro-4-methoxyphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/C(=N\CC2CCCO2)Nc2ccc(OC)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-27-16-6-3-5-14(11-16)20(26)25-21(23-13-17-7-4-10-29-17)24-15-8-9-19(28-2)18(22)12-15/h3,5-6,8-9,11-12,17H,4,7,10,13H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | NKDYNXSFOINUHK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|