C22H26ClN3O5 — CID 94089644
N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,5-dimethoxybenzamide (PubChem CID 94089644) has the molecular formula C22H26ClN3O5 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 94089644 |
| Molecular Formula | C22H26ClN3O5 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/C(=N\C[C@H]2CCCO2)Nc2cc(Cl)ccc2OC)c1 |
| InChI | InChI=1S/C22H26ClN3O5/c1-28-17-9-14(10-18(12-17)29-2)21(27)26-22(24-13-16-5-4-8-31-16)25-19-11-15(23)6-7-20(19)30-3/h6-7,9-12,16H,4-5,8,13H2,1-3H3,(H2,24,25,26,27)/t16-/m1/s1 |
| InChIKey | NILACFBXWVAKQM-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|