C24H30N4O4 — CID 94090288
3-acetamido-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 94090288) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-acetamido-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide.
| Compound Name | 3-acetamido-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 94090288 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-acetamido-N-[N-(2-methoxy-5-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | COc1ccc(C)cc1N/C(=N/C[C@H]1CCCO1)NC(=O)c1ccc(C)c(NC(C)=O)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-15-7-10-22(31-4)21(12-15)27-24(25-14-19-6-5-11-32-19)28-23(30)18-9-8-16(2)20(13-18)26-17(3)29/h7-10,12-13,19H,5-6,11,14H2,1-4H3,(H,26,29)(H2,25,27,28,30)/t19-/m1/s1 |
| InChIKey | WMFIDJKFVZWACB-LJQANCHMSA-N |
| XLogP | 3.65 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|