C23H28N4O4 — CID 94089964
3-acetamido-N-[N-(2-methoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 94089964) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-acetamido-N-[N-(2-methoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide.
| Compound Name | 3-acetamido-N-[N-(2-methoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 94089964 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 3-acetamido-N-[N-(2-methoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | COc1ccccc1N/C(=N/C[C@@H]1CCCO1)NC(=O)c1ccc(C)c(NC(C)=O)c1 |
| InChI | InChI=1S/C23H28N4O4/c1-15-10-11-17(13-20(15)25-16(2)28)22(29)27-23(24-14-18-7-6-12-31-18)26-19-8-4-5-9-21(19)30-3/h4-5,8-11,13,18H,6-7,12,14H2,1-3H3,(H,25,28)(H2,24,26,27,29)/t18-/m0/s1 |
| InChIKey | SZUWEUSEYWRFEO-SFHVURJKSA-N |
| XLogP | 3.34 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|