C24H30N4O3 — CID 94089695
3-acetamido-N-[N-(2,4-dimethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 94089695) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-acetamido-N-[N-(2,4-dimethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide.
| Compound Name | 3-acetamido-N-[N-(2,4-dimethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 94089695 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 3-acetamido-N-[N-(2,4-dimethylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | CC(=O)Nc1cc(C(=O)N/C(=N\C[C@@H]2CCCO2)Nc2ccc(C)cc2C)ccc1C |
| InChI | InChI=1S/C24H30N4O3/c1-15-7-10-21(17(3)12-15)27-24(25-14-20-6-5-11-31-20)28-23(30)19-9-8-16(2)22(13-19)26-18(4)29/h7-10,12-13,20H,5-6,11,14H2,1-4H3,(H,26,29)(H2,25,27,28,30)/t20-/m0/s1 |
| InChIKey | UKZWAIYYALGKML-FQEVSTJZSA-N |
| XLogP | 3.95 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|