C23H30N4O2 — CID 94089702
3-(dimethylamino)-N-[N-(2,5-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide (PubChem CID 94089702) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[N-(2,5-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[N-(2,5-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94089702 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 3-(dimethylamino)-N-[N-(2,5-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
| SMILES | Cc1ccc(C)c(N/C(=N/C[C@H]2CCCO2)NC(=O)c2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-16-10-11-17(2)21(13-16)25-23(24-15-20-9-6-12-29-20)26-22(28)18-7-5-8-19(14-18)27(3)4/h5,7-8,10-11,13-14,20H,6,9,12,15H2,1-4H3,(H2,24,25,26,28)/t20-/m1/s1 |
| InChIKey | LZLATTJQSZIGRG-HXUWFJFHSA-N |
| XLogP | 3.75 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|