C21H25N3O3 — CID 50817286
3-methoxy-N-[N-(3-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50817286) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-methoxy-N-[N-(3-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 3-methoxy-N-[N-(3-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50817286 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-methoxy-N-[N-(3-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
| SMILES | COc1cccc(C(=O)N/C(=N\CC2CCCO2)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-15-6-3-8-17(12-15)23-21(22-14-19-10-5-11-27-19)24-20(25)16-7-4-9-18(13-16)26-2/h3-4,6-9,12-13,19H,5,10-11,14H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | FEFHZLHEOTYLMY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|