C21H24ClN3O2 — CID 94090436
N-[N-(4-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 94090436) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[N-(4-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide.
| Compound Name | N-[N-(4-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 94090436 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[N-(4-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=N\C[C@H]2CCCO2)Nc2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-14-5-7-16(8-6-14)20(26)25-21(23-13-18-4-3-11-27-18)24-19-10-9-17(22)12-15(19)2/h5-10,12,18H,3-4,11,13H2,1-2H3,(H2,23,24,25,26)/t18-/m1/s1 |
| InChIKey | ZZCUIFZFICEXDP-GOSISDBHSA-N |
| XLogP | 4.33 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|