C22H26ClN3O3 — CID 94089475
N-[N-(5-chloro-2-methylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-ethoxybenzamide (PubChem CID 94089475) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[N-(5-chloro-2-methylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-ethoxybenzamide.
| Compound Name | N-[N-(5-chloro-2-methylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 94089475 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[N-(5-chloro-2-methylphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/C(=N\C[C@@H]2CCCO2)Nc2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-3-28-18-10-7-16(8-11-18)21(27)26-22(24-14-19-5-4-12-29-19)25-20-13-17(23)9-6-15(20)2/h6-11,13,19H,3-5,12,14H2,1-2H3,(H2,24,25,26,27)/t19-/m0/s1 |
| InChIKey | HDALVRNXQIYRIW-IBGZPJMESA-N |
| XLogP | 4.42 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|