C24H31N3O3 — CID 94089867
4-ethoxy-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide (PubChem CID 94089867) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-ethoxy-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide.
| Compound Name | 4-ethoxy-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94089867 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 4-ethoxy-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
| SMILES | CCOc1ccc(C(=O)N/C(=N\C[C@@H]2CCCO2)Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-4-29-21-13-9-19(10-14-21)23(28)27-24(25-16-22-6-5-15-30-22)26-20-11-7-18(8-12-20)17(2)3/h7-14,17,22H,4-6,15-16H2,1-3H3,(H2,25,26,27,28)/t22-/m0/s1 |
| InChIKey | GQWBYIQFTWVILD-QFIPXVFZSA-N |
| XLogP | 4.59 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|