C21H24ClN3O3 — CID 94089412
3-chloro-N-[N-(4-ethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide (PubChem CID 94089412) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 3-chloro-N-[N-(4-ethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N-(4-ethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94089412 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-chloro-N-[N-(4-ethoxyphenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]benzamide |
| SMILES | CCOc1ccc(N/C(=N/C[C@@H]2CCCO2)NC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-2-27-18-10-8-17(9-11-18)24-21(23-14-19-7-4-12-28-19)25-20(26)15-5-3-6-16(22)13-15/h3,5-6,8-11,13,19H,2,4,7,12,14H2,1H3,(H2,23,24,25,26)/t19-/m0/s1 |
| InChIKey | NIDHKEPNKRSYMS-IBGZPJMESA-N |
| XLogP | 4.12 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|