C23H29N3O3 — CID 50819921
N-[N-(3,5-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide (PubChem CID 50819921) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[N-(3,5-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide.
| Compound Name | N-[N-(3,5-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 50819921 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[N-(3,5-dimethylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/C(=N\CC2CCCO2)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-4-28-20-9-7-18(8-10-20)22(27)26-23(24-15-21-6-5-11-29-21)25-19-13-16(2)12-17(3)14-19/h7-10,12-14,21H,4-6,11,15H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | BFGXHWMIWFZBAY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|