C20H22ClN3O2 — CID 50817284
4-chloro-N-[N-(4-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50817284) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 4-chloro-N-[N-(4-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(4-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50817284 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-chloro-N-[N-(4-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
| SMILES | Cc1ccc(N/C(=N/CC2CCCO2)NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-14-4-10-17(11-5-14)23-20(22-13-18-3-2-12-26-18)24-19(25)15-6-8-16(21)9-7-15/h4-11,18H,2-3,12-13H2,1H3,(H2,22,23,24,25) |
| InChIKey | XSETWEVSXLBPHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|