C21H22ClN3O4 — CID 50820303
4-chloro-N-[N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50820303) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is 4-chloro-N-[N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50820303 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-chloro-N-[N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\CC1CCCO1)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O4/c22-15-5-3-14(4-6-15)20(26)25-21(23-13-17-2-1-9-27-17)24-16-7-8-18-19(12-16)29-11-10-28-18/h3-8,12,17H,1-2,9-11,13H2,(H2,23,24,25,26) |
| InChIKey | UPFZRGZFEIDWNM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|