C22H23N3O6 — CID 94090458
methyl 4-[[N-(1,3-benzodioxol-5-yl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]carbamoyl]benzoate (PubChem CID 94090458) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 4-[[N-(1,3-benzodioxol-5-yl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[N-(1,3-benzodioxol-5-yl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 94090458 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | methyl 4-[[N-(1,3-benzodioxol-5-yl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N/C(=N\C[C@H]2CCCO2)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H23N3O6/c1-28-21(27)15-6-4-14(5-7-15)20(26)25-22(23-12-17-3-2-10-29-17)24-16-8-9-18-19(11-16)31-13-30-18/h4-9,11,17H,2-3,10,12-13H2,1H3,(H2,23,24,25,26)/t17-/m1/s1 |
| InChIKey | IUUXTDANXAUAGX-QGZVFWFLSA-N |
| XLogP | 2.58 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|