C22H24N4O5 — CID 50820214
3-acetamido-N-[N-(1,3-benzodioxol-5-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50820214) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3-acetamido-N-[N-(1,3-benzodioxol-5-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 3-acetamido-N-[N-(1,3-benzodioxol-5-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50820214 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-acetamido-N-[N-(1,3-benzodioxol-5-yl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)N/C(=N\CC2CCCO2)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C22H24N4O5/c1-14(27)24-16-5-2-4-15(10-16)21(28)26-22(23-12-18-6-3-9-29-18)25-17-7-8-19-20(11-17)31-13-30-19/h2,4-5,7-8,10-11,18H,3,6,9,12-13H2,1H3,(H,24,27)(H2,23,25,26,28) |
| InChIKey | VMPFBWRIDAYCTC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|