C21H25N3O2 — CID 94089383
4-ethyl-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-phenylcarbamimidoyl]benzamide (PubChem CID 94089383) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-ethyl-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-phenylcarbamimidoyl]benzamide.
| Compound Name | 4-ethyl-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-phenylcarbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94089383 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-ethyl-N-[N'-[[(2S)-oxolan-2-yl]methyl]-N-phenylcarbamimidoyl]benzamide |
| SMILES | CCc1ccc(C(=O)N/C(=N\C[C@@H]2CCCO2)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-2-16-10-12-17(13-11-16)20(25)24-21(22-15-19-9-6-14-26-19)23-18-7-4-3-5-8-18/h3-5,7-8,10-13,19H,2,6,9,14-15H2,1H3,(H2,22,23,24,25)/t19-/m0/s1 |
| InChIKey | GLUWDSCJGTVFCD-IBGZPJMESA-N |
| XLogP | 3.63 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|