C20H19F4N3O2 — CID 94090482
3-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide (PubChem CID 94090482) has the molecular formula C20H19F4N3O2 and a molecular weight of 409.38 g/mol. Its IUPAC name is 3-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide.
| Compound Name | 3-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 94090482 |
| Molecular Formula | C20H19F4N3O2 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-fluoro-N-[N'-[[(2R)-oxolan-2-yl]methyl]-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\C[C@H]1CCCO1)Nc1cccc(C(F)(F)F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H19F4N3O2/c21-15-6-1-4-13(10-15)18(28)27-19(25-12-17-8-3-9-29-17)26-16-7-2-5-14(11-16)20(22,23)24/h1-2,4-7,10-11,17H,3,8-9,12H2,(H2,25,26,27,28)/t17-/m1/s1 |
| InChIKey | ZQFJDYNTZKSJSJ-QGZVFWFLSA-N |
| XLogP | 4.22 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|