C22H26FN3O5 — CID 50820174
N-[N-(3-fluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 50820174) has the molecular formula C22H26FN3O5 and a molecular weight of 431.46 g/mol. Its IUPAC name is N-[N-(3-fluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[N-(3-fluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 50820174 |
| Molecular Formula | C22H26FN3O5 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[N-(3-fluorophenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/C(=N\CC2CCCO2)Nc2cccc(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26FN3O5/c1-28-18-10-14(11-19(29-2)20(18)30-3)21(27)26-22(24-13-17-8-5-9-31-17)25-16-7-4-6-15(23)12-16/h4,6-7,10-12,17H,5,8-9,13H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | XVXRWOHQTAEICF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|