C24H31N3O5 — CID 94090123
N-[N-(2,3-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 94090123) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[N-(2,3-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[N-(2,3-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 94090123 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-[N-(2,3-dimethylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/C(=N\C[C@H]2CCCO2)Nc2cccc(C)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C24H31N3O5/c1-15-8-6-10-19(16(15)2)26-24(25-14-18-9-7-11-32-18)27-23(28)17-12-20(29-3)22(31-5)21(13-17)30-4/h6,8,10,12-13,18H,7,9,11,14H2,1-5H3,(H2,25,26,27,28)/t18-/m1/s1 |
| InChIKey | PDTDSYMEFGCZPA-GOSISDBHSA-N |
| XLogP | 3.71 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|