C23H28ClN3O5 — CID 94089678
N-[N-(3-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 94089678) has the molecular formula C23H28ClN3O5 and a molecular weight of 461.95 g/mol. Its IUPAC name is N-[N-(3-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[N-(3-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 94089678 |
| Molecular Formula | C23H28ClN3O5 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-[N-(3-chloro-2-methylphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/C(=N\C[C@H]2CCCO2)Nc2cccc(Cl)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C23H28ClN3O5/c1-14-17(24)8-5-9-18(14)26-23(25-13-16-7-6-10-32-16)27-22(28)15-11-19(29-2)21(31-4)20(12-15)30-3/h5,8-9,11-12,16H,6-7,10,13H2,1-4H3,(H2,25,26,27,28)/t16-/m1/s1 |
| InChIKey | VJVKYGXKCJKULZ-MRXNPFEDSA-N |
| XLogP | 4.05 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|