C19H18BrF2N3O2 — CID 94090395
N-[N-(3-bromophenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 94090395) has the molecular formula C19H18BrF2N3O2 and a molecular weight of 438.27 g/mol. Its IUPAC name is N-[N-(3-bromophenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-(3-bromophenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 94090395 |
| Molecular Formula | C19H18BrF2N3O2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-[N-(3-bromophenyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | O=C(N/C(=N\C[C@@H]1CCCO1)Nc1cccc(Br)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H18BrF2N3O2/c20-13-3-1-4-14(10-13)24-19(23-11-15-5-2-8-27-15)25-18(26)12-6-7-16(21)17(22)9-12/h1,3-4,6-7,9-10,15H,2,5,8,11H2,(H2,23,24,25,26)/t15-/m0/s1 |
| InChIKey | FIWAQVMFCRSHSJ-HNNXBMFYSA-N |
| XLogP | 4.10 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|