C13H17Cl2N3 — CID 57050729
2-(cyclopropylmethyl)-3-(2,6-dichlorophenyl)-1,1-dimethylguanidine (PubChem CID 57050729) has the molecular formula C13H17Cl2N3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-3-(2,6-dichlorophenyl)-1,1-dimethylguanidine.
| Compound Name | 2-(cyclopropylmethyl)-3-(2,6-dichlorophenyl)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 57050729 |
| Molecular Formula | C13H17Cl2N3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(cyclopropylmethyl)-3-(2,6-dichlorophenyl)-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\CC1CC1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H17Cl2N3/c1-18(2)13(16-8-9-6-7-9)17-12-10(14)4-3-5-11(12)15/h3-5,9H,6-8H2,1-2H3,(H,16,17) |
| InChIKey | HRLYGPVZXJVMCT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|