C16H20Cl2N2O2 — CID 7780171
2-cyclopentyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylacetamide (PubChem CID 7780171) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-cyclopentyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 7780171 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-cyclopentyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylacetamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)CC1CCCC1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-20(15(22)9-11-5-2-3-6-11)10-14(21)19-16-12(17)7-4-8-13(16)18/h4,7-8,11H,2-3,5-6,9-10H2,1H3,(H,19,21) |
| InChIKey | KDTKCTQMPBIQCT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |