C13H12Cl4N2O2 — CID 78772127
2,2-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylcyclopropane-1-carboxamide (PubChem CID 78772127) has the molecular formula C13H12Cl4N2O2 and a molecular weight of 370.06 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78772127 |
| Molecular Formula | C13H12Cl4N2O2 |
| Molecular Weight | 370.06 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 2,2-dichloro-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylcyclopropane-1-carboxamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C13H12Cl4N2O2/c1-19(12(21)7-5-13(7,16)17)6-10(20)18-11-8(14)3-2-4-9(11)15/h2-4,7H,5-6H2,1H3,(H,18,20) |
| InChIKey | ASBUYVMOKARCBZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.06 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|