C23H18Cl2N2O3 — CID 26899017
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-9H-xanthene-9-carboxamide (PubChem CID 26899017) has the molecular formula C23H18Cl2N2O3 and a molecular weight of 441.31 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-9H-xanthene-9-carboxamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 26899017 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-9H-xanthene-9-carboxamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C23H18Cl2N2O3/c1-27(13-20(28)26-22-16(24)9-6-10-17(22)25)23(29)21-14-7-2-4-11-18(14)30-19-12-5-3-8-15(19)21/h2-12,21H,13H2,1H3,(H,26,28) |
| InChIKey | UOHQUDXRSMHSBG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |