C13H18Cl2N2O — CID 4674154
3-(2,6-dichlorophenyl)-1,1-di(propan-2-yl)urea (PubChem CID 4674154) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1,1-di(propan-2-yl)urea.
| Compound Name | 3-(2,6-dichlorophenyl)-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 4674154 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)Nc1c(Cl)cccc1Cl)C(C)C |
| InChI | InChI=1S/C13H18Cl2N2O/c1-8(2)17(9(3)4)13(18)16-12-10(14)6-5-7-11(12)15/h5-9H,1-4H3,(H,16,18) |
| InChIKey | OGAQJVWGVFCBFL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |