C16H16Cl2F7N3O2 — CID 142632464
N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 142632464) has the molecular formula C16H16Cl2F7N3O2 and a molecular weight of 486.22 g/mol. Its IUPAC name is N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 142632464 |
| Molecular Formula | C16H16Cl2F7N3O2 |
| Molecular Weight | 486.22 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CC(C)CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2F7N3O2/c1-7(2)5-11(12(29)28-27-10-4-3-8(17)6-9(10)18)26-13(30)14(19,20)15(21,22)16(23,24)25/h3-4,6-7,11,27H,5H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | JENNECYGYFGGIG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|