C14H5ClF14N2O2 — CID 91725178
N-[4-chloro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 91725178) has the molecular formula C14H5ClF14N2O2 and a molecular weight of 534.63 g/mol. Its IUPAC name is N-[4-chloro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[4-chloro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 91725178 |
| Molecular Formula | C14H5ClF14N2O2 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 533.98 |
| IUPAC Name | N-[4-chloro-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(Nc1ccc(Cl)cc1NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H5ClF14N2O2/c15-4-1-2-5(30-7(32)9(16,17)11(20,21)13(24,25)26)6(3-4)31-8(33)10(18,19)12(22,23)14(27,28)29/h1-3H,(H,30,32)(H,31,33) |
| InChIKey | AOFMAGHWGJVFJD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|