C8H6ClF3N2O — CID 14399786
N-(2-amino-4-chlorophenyl)-2,2,2-trifluoroacetamide (PubChem CID 14399786) has the molecular formula C8H6ClF3N2O and a molecular weight of 238.60 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 14399786 |
| Molecular Formula | C8H6ClF3N2O |
| Molecular Weight | 238.60 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-2,2,2-trifluoroacetamide |
| SMILES | Nc1cc(Cl)ccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H6ClF3N2O/c9-4-1-2-6(5(13)3-4)14-7(15)8(10,11)12/h1-3H,13H2,(H,14,15) |
| InChIKey | RFUNHILYJOODNW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|