C8H5F5N2O — CID 110481225
N-(2-amino-3,4-difluorophenyl)-2,2,2-trifluoroacetamide (PubChem CID 110481225) has the molecular formula C8H5F5N2O and a molecular weight of 240.13 g/mol. Its IUPAC name is N-(2-amino-3,4-difluorophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-amino-3,4-difluorophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 110481225 |
| Molecular Formula | C8H5F5N2O |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | N-(2-amino-3,4-difluorophenyl)-2,2,2-trifluoroacetamide |
| SMILES | Nc1c(NC(=O)C(F)(F)F)ccc(F)c1F |
| InChI | InChI=1S/C8H5F5N2O/c9-3-1-2-4(6(14)5(3)10)15-7(16)8(11,12)13/h1-2H,14H2,(H,15,16) |
| InChIKey | LKQIIHLJGKGPRV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|