C8H5F4NO2 — CID 15688157
2,2,2-trifluoro-N-(5-fluoro-2-hydroxyphenyl)acetamide (PubChem CID 15688157) has the molecular formula C8H5F4NO2 and a molecular weight of 223.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(5-fluoro-2-hydroxyphenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(5-fluoro-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 15688157 |
| Molecular Formula | C8H5F4NO2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2,2,2-trifluoro-N-(5-fluoro-2-hydroxyphenyl)acetamide |
| SMILES | O=C(Nc1cc(F)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C8H5F4NO2/c9-4-1-2-6(14)5(3-4)13-7(15)8(10,11)12/h1-3,14H,(H,13,15) |
| InChIKey | ZPGMBNMIELOUBK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|